About (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine
(2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine (PubChem CID 121405139) has the molecular formula C16H27F2N
and a molecular weight of 271.39 g/mol. Its IUPAC name is (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine.
Molecular Properties
| Compound Name | (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine |
| PubChem CID | 121405139 |
| Molecular Formula | C16H27F2N |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine |
| SMILES | C/C=C(\C=N\C(=C\CCC)C(F)F)[C@@H](C)CCCC |
| InChI | InChI=1S/C16H27F2N/c1-5-8-10-13(4)14(7-3)12-19-15(16(17)18)11-9-6-2/h7,11-13,16H,5-6,8-10H2,1-4H3/b14-7+,15-11+,19-12+/t13-/m0/s1 |
| InChIKey | HKFUOWDBIXLNDT-SUYCVSAASA-N |
| XLogP | 5.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine?
The IUPAC name of (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine (CID 121405139) is (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine.
What is the SMILES notation for (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine?
The canonical SMILES for (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine is C/C=C(\C=N\C(=C\CCC)C(F)F)[C@@H](C)CCCC.
What is the InChIKey of (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine?
The InChIKey is HKFUOWDBIXLNDT-SUYCVSAASA-N. The full InChI is InChI=1S/C16H27F2N/c1-5-8-10-13(4)14(7-3)12-19-15(16(17)18)11-9-6-2/h7,11-13,16H,5-6,8-10H2,1-4H3/b14-7+,15-11+,19-12+/t13-/m0/s1.
What are the key properties of (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine?
(2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine has a molecular weight of 271.39 g/mol, XLogP of 5.78, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3S)-N-[(E)-1,1-difluorohex-2-en-2-yl]-2-ethylidene-3-methylheptan-1-imine is sourced from PubChem (CID 121405139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).