C17H28F3N — CID 121405211
N-[(E,3S)-2-ethenyl-3-ethylhept-1-enyl]-1,1,1-trifluorohexan-2-imine (PubChem CID 121405211) has the molecular formula C17H28F3N and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[(E,3S)-2-ethenyl-3-ethylhept-1-enyl]-1,1,1-trifluorohexan-2-imine.
| Compound Name | N-[(E,3S)-2-ethenyl-3-ethylhept-1-enyl]-1,1,1-trifluorohexan-2-imine |
|---|---|
| PubChem CID | 121405211 |
| Molecular Formula | C17H28F3N |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[(E,3S)-2-ethenyl-3-ethylhept-1-enyl]-1,1,1-trifluorohexan-2-imine |
| SMILES | C=C/C(=C\N=C(/CCCC)C(F)(F)F)[C@@H](CC)CCCC |
| InChI | InChI=1S/C17H28F3N/c1-5-9-11-14(7-3)15(8-4)13-21-16(12-10-6-2)17(18,19)20/h8,13-14H,4-7,9-12H2,1-3H3/b15-13+,21-16+/t14-/m0/s1 |
| InChIKey | AEVAYFQWGAMOJU-SKLVGSPZSA-N |
| XLogP | 6.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|