C13H13Cl2N3O2 — CID 121405312
prop-2-enyl N-[3-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]carbamate (PubChem CID 121405312) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is prop-2-enyl N-[3-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[3-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 121405312 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | prop-2-enyl N-[3-(3,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CNN=C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-2-5-20-13(19)17-11-7-16-18-12(11)8-3-4-9(14)10(15)6-8/h2-4,6,11,16H,1,5,7H2,(H,17,19) |
| InChIKey | NIMTUMAMRXVLTF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|