C24H24N6 — CID 121405389
N,N'-bis[(2-phenylpyrimidin-5-yl)methyl]ethane-1,2-diamine (PubChem CID 121405389) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is N,N'-bis[(2-phenylpyrimidin-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[(2-phenylpyrimidin-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 121405389 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N,N'-bis[(2-phenylpyrimidin-5-yl)methyl]ethane-1,2-diamine |
| SMILES | c1ccc(-c2ncc(CNCCNCc3cnc(-c4ccccc4)nc3)cn2)cc1 |
| InChI | InChI=1S/C24H24N6/c1-3-7-21(8-4-1)23-27-15-19(16-28-23)13-25-11-12-26-14-20-17-29-24(30-18-20)22-9-5-2-6-10-22/h1-10,15-18,25-26H,11-14H2 |
| InChIKey | RLNGFSXZXLJLPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|