C12H26N2S — CID 121405881
1-N'-cyclohexyl-1-N'-ethylthiolane-1,1-diamine (PubChem CID 121405881) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 1-N'-cyclohexyl-1-N'-ethylthiolane-1,1-diamine.
| Compound Name | 1-N'-cyclohexyl-1-N'-ethylthiolane-1,1-diamine |
|---|---|
| PubChem CID | 121405881 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-N'-cyclohexyl-1-N'-ethylthiolane-1,1-diamine |
| SMILES | CCN(C1CCCCC1)S1(N)CCCC1 |
| InChI | InChI=1S/C12H26N2S/c1-2-14(12-8-4-3-5-9-12)15(13)10-6-7-11-15/h12H,2-11,13H2,1H3 |
| InChIKey | PBQLBVZSOXYTBP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |