About Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate
Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate (PubChem CID 12140614) has the molecular formula C12H16O3
and a molecular weight of 208.25 g/mol. Its IUPAC name is prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate |
| PubChem CID | 12140614 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate |
| SMILES | CC1=CCCC1(C(=O)C)C(=O)OCC=C |
| InChI | InChI=1S/C12H16O3/c1-4-8-15-11(14)12(10(3)13)7-5-6-9(12)2/h4,6H,1,5,7-8H2,2-3H3 |
| InChIKey | AEOFWARMUXCYFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 328 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate?
The IUPAC name of Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate (CID 12140614) is prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate.
What is the SMILES notation for Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate?
The canonical SMILES for Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate is CC1=CCCC1(C(=O)C)C(=O)OCC=C.
What is the InChIKey of Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate?
The InChIKey is AEOFWARMUXCYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-4-8-15-11(14)12(10(3)13)7-5-6-9(12)2/h4,6H,1,5,7-8H2,2-3H3.
What are the key properties of Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate?
Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate has a molecular weight of 208.25 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Prop-2-enyl 1-acetyl-2-methylcyclopent-2-ene-1-carboxylate is sourced from PubChem (CID 12140614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).