C27H32N4O6S2 — CID 121406170
2-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]-N-[2-(2-propoxyethoxy)ethyl]acetamide (PubChem CID 121406170) has the molecular formula C27H32N4O6S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]-N-[2-(2-propoxyethoxy)ethyl]acetamide.
| Compound Name | 2-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]-N-[2-(2-propoxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 121406170 |
| Molecular Formula | C27H32N4O6S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-[2-[5-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]-N-[2-(2-propoxyethoxy)ethyl]acetamide |
| SMILES | CCCOCCOCCNC(=O)Cn1c(Sc2ccc(/C=C3\SC(=O)N(C(C)C)C3=O)o2)nc2ccccc21 |
| InChI | InChI=1S/C27H32N4O6S2/c1-4-12-35-14-15-36-13-11-28-23(32)17-30-21-8-6-5-7-20(21)29-26(30)39-24-10-9-19(37-24)16-22-25(33)31(18(2)3)27(34)38-22/h5-10,16,18H,4,11-15,17H2,1-3H3,(H,28,32)/b22-16- |
| InChIKey | XCWCRNYEAPDQNQ-JWGURIENSA-N |
| XLogP | 4.78 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|