About 2-benzyl-5-(3,5-dinitrophenyl)tetrazole
2-benzyl-5-(3,5-dinitrophenyl)tetrazole (PubChem CID 121406217) has the molecular formula C14H10N6O4
and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-benzyl-5-(3,5-dinitrophenyl)tetrazole.
Molecular Properties
| Compound Name | 2-benzyl-5-(3,5-dinitrophenyl)tetrazole |
| PubChem CID | 121406217 |
| Molecular Formula | C14H10N6O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-benzyl-5-(3,5-dinitrophenyl)tetrazole |
| SMILES | O=[N+]([O-])c1cc(-c2nnn(Cc3ccccc3)n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N6O4/c21-19(22)12-6-11(7-13(8-12)20(23)24)14-15-17-18(16-14)9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | AXUHKBGADYDPCO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-5-(3,5-dinitrophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-(3,5-dinitrophenyl)tetrazole?
The IUPAC name of 2-benzyl-5-(3,5-dinitrophenyl)tetrazole (CID 121406217) is 2-benzyl-5-(3,5-dinitrophenyl)tetrazole.
What is the SMILES notation for 2-benzyl-5-(3,5-dinitrophenyl)tetrazole?
The canonical SMILES for 2-benzyl-5-(3,5-dinitrophenyl)tetrazole is O=[N+]([O-])c1cc(-c2nnn(Cc3ccccc3)n2)cc([N+](=O)[O-])c1.
What is the InChIKey of 2-benzyl-5-(3,5-dinitrophenyl)tetrazole?
The InChIKey is AXUHKBGADYDPCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N6O4/c21-19(22)12-6-11(7-13(8-12)20(23)24)14-15-17-18(16-14)9-10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of 2-benzyl-5-(3,5-dinitrophenyl)tetrazole?
2-benzyl-5-(3,5-dinitrophenyl)tetrazole has a molecular weight of 326.27 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-(3,5-dinitrophenyl)tetrazole is sourced from PubChem (CID 121406217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).