C15H12N6O5 — CID 121406219
5-(3,5-dinitrophenyl)-2-[(3-methoxyphenyl)methyl]tetrazole (PubChem CID 121406219) has the molecular formula C15H12N6O5 and a molecular weight of 356.30 g/mol. Its IUPAC name is 5-(3,5-dinitrophenyl)-2-[(3-methoxyphenyl)methyl]tetrazole.
| Compound Name | 5-(3,5-dinitrophenyl)-2-[(3-methoxyphenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 121406219 |
| Molecular Formula | C15H12N6O5 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 5-(3,5-dinitrophenyl)-2-[(3-methoxyphenyl)methyl]tetrazole |
| SMILES | COc1cccc(Cn2nnc(-c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C15H12N6O5/c1-26-14-4-2-3-10(5-14)9-19-17-15(16-18-19)11-6-12(20(22)23)8-13(7-11)21(24)25/h2-8H,9H2,1H3 |
| InChIKey | KBKMMKAYZWIOCZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|