C27H31N7O2 — CID 121406398
5-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 121406398) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 5-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 121406398 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 5-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | Cc1cccc2ncnc(N3CCCCC3c3cc4nc5c(c(N6CCOCC6)n4n3)COCC5)c12 |
| InChI | InChI=1S/C27H31N7O2/c1-18-5-4-6-21-25(18)26(29-17-28-21)33-9-3-2-7-23(33)22-15-24-30-20-8-12-36-16-19(20)27(34(24)31-22)32-10-13-35-14-11-32/h4-6,15,17,23H,2-3,7-14,16H2,1H3 |
| InChIKey | IMTHZGNNOMKBJF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |