C27H31N7O — CID 121406406
4-[11-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]morpholine (PubChem CID 121406406) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-[11-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]morpholine.
| Compound Name | 4-[11-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]morpholine |
|---|---|
| PubChem CID | 121406406 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-[11-[1-(5-methylquinazolin-4-yl)piperidin-2-yl]-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]morpholine |
| SMILES | Cc1cccc2ncnc(N3CCCCC3c3cc4nc5c(c(N6CCOCC6)n4n3)CCC5)c12 |
| InChI | InChI=1S/C27H31N7O/c1-18-6-4-9-21-25(18)26(29-17-28-21)33-11-3-2-10-23(33)22-16-24-30-20-8-5-7-19(20)27(34(24)31-22)32-12-14-35-15-13-32/h4,6,9,16-17,23H,2-3,5,7-8,10-15H2,1H3 |
| InChIKey | FYNYTJSMCOEMGU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |