C29H35N7O3 — CID 121406416
5-[1-(2-ethoxy-5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 121406416) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 5-[1-(2-ethoxy-5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 5-[1-(2-ethoxy-5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 121406416 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 5-[1-(2-ethoxy-5-methylquinazolin-4-yl)piperidin-2-yl]-8-morpholin-4-yl-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | CCOc1nc(N2CCCCC2c2cc3nc4c(c(N5CCOCC5)n3n2)COCC4)c2c(C)cccc2n1 |
| InChI | InChI=1S/C29H35N7O3/c1-3-39-29-31-22-8-6-7-19(2)26(22)27(32-29)35-11-5-4-9-24(35)23-17-25-30-21-10-14-38-18-20(21)28(36(25)33-23)34-12-15-37-16-13-34/h6-8,17,24H,3-5,9-16,18H2,1-2H3 |
| InChIKey | NRIYAPGGKMPYJP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |