C10H18N2OS — CID 121406425
(3aS,4S,6aR)-4-(2-methylbutan-2-yl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 121406425) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(2-methylbutan-2-yl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-(2-methylbutan-2-yl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 121406425 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (3aS,4S,6aR)-4-(2-methylbutan-2-yl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CCC(C)(C)[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H18N2OS/c1-4-10(2,3)8-7-6(5-14-8)11-9(13)12-7/h6-8H,4-5H2,1-3H3,(H2,11,12,13)/t6-,7-,8+/m0/s1 |
| InChIKey | MRPJDKUSDFURIH-BIIVOSGPSA-N |
| XLogP | 1.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|