C14H8N4O3S2 — CID 121406493
(5Z)-5-[[5-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 121406493) has the molecular formula C14H8N4O3S2 and a molecular weight of 344.38 g/mol. Its IUPAC name is (5Z)-5-[[5-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121406493 |
| Molecular Formula | C14H8N4O3S2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (5Z)-5-[[5-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(Sc3nc4ncccc4[nH]3)o2)S1 |
| InChI | InChI=1S/C14H8N4O3S2/c19-12-9(22-14(20)18-12)6-7-3-4-10(21-7)23-13-16-8-2-1-5-15-11(8)17-13/h1-6H,(H,15,16,17)(H,18,19,20)/b9-6- |
| InChIKey | YYCCAZLENMIDJZ-TWGQIWQCSA-N |
| XLogP | 3.03 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|