About CID 121407418
CID 121407418 (PubChem CID 121407418) has the molecular formula C13H6F9KNO2
and a molecular weight of 418.28 g/mol.
Molecular Properties
| Compound Name | CID 121407418 |
| PubChem CID | 121407418 |
| Molecular Formula | C13H6F9KNO2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(C#N)c1c(F)c(F)c(C(F)(F)F)c(F)c1C(F)(F)F.[K] |
| InChI | InChI=1S/C13H6F9NO2.K/c1-2-25-11(24)4(3-23)5-6(12(17,18)19)9(15)7(13(20,21)22)10(16)8(5)14;/h4H,2H2,1H3; |
| InChIKey | IJWKASPTWOUPND-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze CID 121407418 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 121407418?
The IUPAC name of CID 121407418 (CID 121407418) is not available.
What is the SMILES notation for CID 121407418?
The canonical SMILES for CID 121407418 is CCOC(=O)C(C#N)c1c(F)c(F)c(C(F)(F)F)c(F)c1C(F)(F)F.[K].
What is the InChIKey of CID 121407418?
The InChIKey is IJWKASPTWOUPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F9NO2.K/c1-2-25-11(24)4(3-23)5-6(12(17,18)19)9(15)7(13(20,21)22)10(16)8(5)14;/h4H,2H2,1H3;.
What are the key properties of CID 121407418?
CID 121407418 has a molecular weight of 418.28 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 121407418 is sourced from PubChem (CID 121407418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).