C29H23F4N3O4 — CID 121408003
2-[6-[[(1R)-7-fluoro-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 121408003) has the molecular formula C29H23F4N3O4 and a molecular weight of 553.51 g/mol. Its IUPAC name is 2-[6-[[(1R)-7-fluoro-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[[(1R)-7-fluoro-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 121408003 |
| Molecular Formula | C29H23F4N3O4 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 2-[6-[[(1R)-7-fluoro-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | Cc1nc(-c2ccc(-c3c(C(F)(F)F)cc(F)c4c3CC[C@H]4Oc3ccc4c(c3)OCC4CC(=O)O)cc2)n[nH]1 |
| InChI | InChI=1S/C29H23F4N3O4/c1-14-34-28(36-35-14)16-4-2-15(3-5-16)26-20-8-9-23(27(20)22(30)12-21(26)29(31,32)33)40-18-6-7-19-17(10-25(37)38)13-39-24(19)11-18/h2-7,11-12,17,23H,8-10,13H2,1H3,(H,37,38)(H,34,35,36)/t17?,23-/m1/s1 |
| InChIKey | CYOZBVMUKWXYQK-IRCUZVAFSA-N |
| XLogP | 6.62 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |