C23H26N6O3S — CID 121408398
[4-(1H-indazol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N-(4-hydroxybutyl)-N-methylcarbamate (PubChem CID 121408398) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is [4-(1H-indazol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N-(4-hydroxybutyl)-N-methylcarbamate.
| Compound Name | [4-(1H-indazol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N-(4-hydroxybutyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 121408398 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [4-(1H-indazol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl] N-(4-hydroxybutyl)-N-methylcarbamate |
| SMILES | CN(CCCCO)C(=O)OC1CCc2c(sc3ncnc(Nc4ccc5[nH]ncc5c4)c23)C1 |
| InChI | InChI=1S/C23H26N6O3S/c1-29(8-2-3-9-30)23(31)32-16-5-6-17-19(11-16)33-22-20(17)21(24-13-25-22)27-15-4-7-18-14(10-15)12-26-28-18/h4,7,10,12-13,16,30H,2-3,5-6,8-9,11H2,1H3,(H,26,28)(H,24,25,27) |
| InChIKey | QRIGDZLTWRWPMC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|