C18H26O — CID 121408619
4,5,6,7,8,8-hexamethyl-3,4,6,7-tetrahydro-1H-cyclopenta[g]isochromene (PubChem CID 121408619) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 4,5,6,7,8,8-hexamethyl-3,4,6,7-tetrahydro-1H-cyclopenta[g]isochromene.
| Compound Name | 4,5,6,7,8,8-hexamethyl-3,4,6,7-tetrahydro-1H-cyclopenta[g]isochromene |
|---|---|
| PubChem CID | 121408619 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4,5,6,7,8,8-hexamethyl-3,4,6,7-tetrahydro-1H-cyclopenta[g]isochromene |
| SMILES | Cc1c2c(cc3c1C(C)C(C)C3(C)C)COCC2C |
| InChI | InChI=1S/C18H26O/c1-10-8-19-9-14-7-15-17(12(3)16(10)14)11(2)13(4)18(15,5)6/h7,10-11,13H,8-9H2,1-6H3 |
| InChIKey | UUNBCWOCWXAEFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |