C6H2F8O — CID 121408632
2,3,3,3-tetrafluoro-1-(2,3,3,3-tetrafluoroprop-1-enoxy)prop-1-ene (PubChem CID 121408632) has the molecular formula C6H2F8O and a molecular weight of 242.06 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-1-(2,3,3,3-tetrafluoroprop-1-enoxy)prop-1-ene.
| Compound Name | 2,3,3,3-tetrafluoro-1-(2,3,3,3-tetrafluoroprop-1-enoxy)prop-1-ene |
|---|---|
| PubChem CID | 121408632 |
| Molecular Formula | C6H2F8O |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-1-(2,3,3,3-tetrafluoroprop-1-enoxy)prop-1-ene |
| SMILES | FC(=COC=C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F8O/c7-3(5(9,10)11)1-15-2-4(8)6(12,13)14/h1-2H |
| InChIKey | RAOHSZQQKCBEAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|