C24H28N8O3 — CID 121409100
4-[[(1S,2R)-2-cyanocyclopropyl]methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide (PubChem CID 121409100) has the molecular formula C24H28N8O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-cyanocyclopropyl]methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-cyanocyclopropyl]methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121409100 |
| Molecular Formula | C24H28N8O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-[[(1S,2R)-2-cyanocyclopropyl]methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide |
| SMILES | C[C@H](CO)NC(=O)c1nc(OC[C@H]2C[C@H]2C#N)nc(N2CCC(c3c[nH]c4ncccc34)CC2)n1 |
| InChI | InChI=1S/C24H28N8O3/c1-14(12-33)28-22(34)21-29-23(31-24(30-21)35-13-17-9-16(17)10-25)32-7-4-15(5-8-32)19-11-27-20-18(19)3-2-6-26-20/h2-3,6,11,14-17,33H,4-5,7-9,12-13H2,1H3,(H,26,27)(H,28,34)/t14-,16+,17-/m1/s1 |
| InChIKey | GEUVOYNQVOWBQY-HYVNUMGLSA-N |
| XLogP | 1.78 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |