C25H27F3N8O3 — CID 121409177
4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide (PubChem CID 121409177) has the molecular formula C25H27F3N8O3 and a molecular weight of 544.54 g/mol. Its IUPAC name is 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121409177 |
| Molecular Formula | C25H27F3N8O3 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
| SMILES | COc1ccnc2[nH]cc(C3CCN(c4nc(OCC5(C#N)CC5)nc(C(=O)N[C@@H](C)C(F)(F)F)n4)CC3)c12 |
| InChI | InChI=1S/C25H27F3N8O3/c1-14(25(26,27)28)32-21(37)20-33-22(35-23(34-20)39-13-24(12-29)6-7-24)36-9-4-15(5-10-36)16-11-31-19-18(16)17(38-2)3-8-30-19/h3,8,11,14-15H,4-7,9-10,13H2,1-2H3,(H,30,31)(H,32,37)/t14-/m0/s1 |
| InChIKey | RITUKWNADYMJLT-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |