C24H29F3N8O4 — CID 121409190
4-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-6-[[(2R)-oxolan-2-yl]methoxy]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide (PubChem CID 121409190) has the molecular formula C24H29F3N8O4 and a molecular weight of 550.54 g/mol. Its IUPAC name is 4-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-6-[[(2R)-oxolan-2-yl]methoxy]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-6-[[(2R)-oxolan-2-yl]methoxy]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121409190 |
| Molecular Formula | C24H29F3N8O4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 4-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-6-[[(2R)-oxolan-2-yl]methoxy]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
| SMILES | COc1ccnc2n[nH]c(C3CCN(c4nc(OC[C@H]5CCCO5)nc(C(=O)N[C@@H](C)C(F)(F)F)n4)CC3)c12 |
| InChI | InChI=1S/C24H29F3N8O4/c1-13(24(25,26)27)29-21(36)20-30-22(32-23(31-20)39-12-15-4-3-11-38-15)35-9-6-14(7-10-35)18-17-16(37-2)5-8-28-19(17)34-33-18/h5,8,13-15H,3-4,6-7,9-12H2,1-2H3,(H,29,36)(H,28,33,34)/t13-,15+/m0/s1 |
| InChIKey | YYLDULHRAWXCRN-DZGCQCFKSA-N |
| XLogP | 2.77 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |