C22H26F2N8O3 — CID 121409204
4-[(2,2-difluorocyclopropyl)methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide (PubChem CID 121409204) has the molecular formula C22H26F2N8O3 and a molecular weight of 488.50 g/mol. Its IUPAC name is 4-[(2,2-difluorocyclopropyl)methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[(2,2-difluorocyclopropyl)methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121409204 |
| Molecular Formula | C22H26F2N8O3 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-[(2,2-difluorocyclopropyl)methoxy]-N-[(2R)-1-hydroxypropan-2-yl]-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-1,3,5-triazine-2-carboxamide |
| SMILES | C[C@H](CO)NC(=O)c1nc(OCC2CC2(F)F)nc(N2CCC(c3[nH]nc4ncccc34)CC2)n1 |
| InChI | InChI=1S/C22H26F2N8O3/c1-12(10-33)26-19(34)18-27-20(29-21(28-18)35-11-14-9-22(14,23)24)32-7-4-13(5-8-32)16-15-3-2-6-25-17(15)31-30-16/h2-3,6,12-14,33H,4-5,7-11H2,1H3,(H,26,34)(H,25,30,31)/t12-,14?/m1/s1 |
| InChIKey | ZPCBBPWDLNOYTK-PUODRLBUSA-N |
| XLogP | 1.67 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |