C22H25F3N8O2 — CID 121409624
4-(cyclopropylmethoxy)-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide (PubChem CID 121409624) has the molecular formula C22H25F3N8O2 and a molecular weight of 490.49 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-(cyclopropylmethoxy)-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121409624 |
| Molecular Formula | C22H25F3N8O2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 4-(cyclopropylmethoxy)-6-[4-(2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1nc(OCC2CC2)nc(N2CCC(c3[nH]nc4ncccc34)CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3N8O2/c1-12(22(23,24)25)27-19(34)18-28-20(30-21(29-18)35-11-13-4-5-13)33-9-6-14(7-10-33)16-15-3-2-8-26-17(15)32-31-16/h2-3,8,12-14H,4-7,9-11H2,1H3,(H,27,34)(H,26,31,32)/t12-/m0/s1 |
| InChIKey | YLJCVWCRNSGHGI-LBPRGKRZSA-N |
| XLogP | 3.00 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |