C28H28N2O6 — CID 121409747
methyl 7-hydroxy-3-[6-[(3R)-3-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3-benzodioxol-5-yl]-5,6,7,8-tetrahydroindolizine-1-carboxylate (PubChem CID 121409747) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is methyl 7-hydroxy-3-[6-[(3R)-3-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3-benzodioxol-5-yl]-5,6,7,8-tetrahydroindolizine-1-carboxylate.
| Compound Name | methyl 7-hydroxy-3-[6-[(3R)-3-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3-benzodioxol-5-yl]-5,6,7,8-tetrahydroindolizine-1-carboxylate |
|---|---|
| PubChem CID | 121409747 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | methyl 7-hydroxy-3-[6-[(3R)-3-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3-benzodioxol-5-yl]-5,6,7,8-tetrahydroindolizine-1-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc3c(cc2C(=O)N2Cc4ccccc4C[C@H]2C)OCO3)n2c1CC(O)CC2 |
| InChI | InChI=1S/C28H28N2O6/c1-16-9-17-5-3-4-6-18(17)14-30(16)27(32)21-13-26-25(35-15-36-26)12-20(21)24-11-22(28(33)34-2)23-10-19(31)7-8-29(23)24/h3-6,11-13,16,19,31H,7-10,14-15H2,1-2H3/t16-,19?/m1/s1 |
| InChIKey | GFQVKQYYERJWIR-VTBWFHPJSA-N |
| XLogP | 3.56 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |