C14H10F2O3 — CID 121409988
2-(3,5-difluorophenyl)-1-(2,5-dihydroxyphenyl)ethanone (PubChem CID 121409988) has the molecular formula C14H10F2O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(2,5-dihydroxyphenyl)ethanone.
| Compound Name | 2-(3,5-difluorophenyl)-1-(2,5-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 121409988 |
| Molecular Formula | C14H10F2O3 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(2,5-dihydroxyphenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(F)c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H10F2O3/c15-9-3-8(4-10(16)6-9)5-14(19)12-7-11(17)1-2-13(12)18/h1-4,6-7,17-18H,5H2 |
| InChIKey | BOHLWOMNVOURGF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|