C23H27FN6O3 — CID 121410161
5-(3-fluoro-4-morpholin-4-ylanilino)-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 121410161) has the molecular formula C23H27FN6O3 and a molecular weight of 454.51 g/mol. Its IUPAC name is 5-(3-fluoro-4-morpholin-4-ylanilino)-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-fluoro-4-morpholin-4-ylanilino)-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410161 |
| Molecular Formula | C23H27FN6O3 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-(3-fluoro-4-morpholin-4-ylanilino)-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Nc3ccc(N4CCOCC4)c(F)c3)c2C(N)=O)cc(C)c1O |
| InChI | InChI=1S/C23H27FN6O3/c1-13-9-15(10-14(2)20(13)31)12-26-22-19(21(25)32)23(29-28-22)27-16-3-4-18(17(24)11-16)30-5-7-33-8-6-30/h3-4,9-11,31H,5-8,12H2,1-2H3,(H2,25,32)(H3,26,27,28,29) |
| InChIKey | UIYIALBJVVTFOP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|