C16H21ClN6O2 — CID 121410166
5-amino-3-[3-chloro-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]-1H-pyrazole-4-carboxamide (PubChem CID 121410166) has the molecular formula C16H21ClN6O2 and a molecular weight of 364.84 g/mol. Its IUPAC name is 5-amino-3-[3-chloro-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[3-chloro-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410166 |
| Molecular Formula | C16H21ClN6O2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-amino-3-[3-chloro-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]-1H-pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(Nc3n[nH]c(N)c3C(N)=O)cc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C16H21ClN6O2/c1-8-6-23(7-9(2)25-8)12-4-3-10(5-11(12)17)20-16-13(15(19)24)14(18)21-22-16/h3-5,8-9H,6-7H2,1-2H3,(H2,19,24)(H4,18,20,21,22)/t8-,9+ |
| InChIKey | GKMNGJYJLOTKJJ-DTORHVGOSA-N |
| XLogP | 2.10 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|