C25H32N6O3 — CID 121410171
5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 121410171) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410171 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Nc3ccc(N4CC(C)OC(C)C4)cc3)c2C(N)=O)cc(C)c1O |
| InChI | InChI=1S/C25H32N6O3/c1-14-9-18(10-15(2)22(14)32)11-27-24-21(23(26)33)25(30-29-24)28-19-5-7-20(8-6-19)31-12-16(3)34-17(4)13-31/h5-10,16-17,32H,11-13H2,1-4H3,(H2,26,33)(H3,27,28,29,30) |
| InChIKey | JQRLMAXFRRUBFO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|