C24H29FN6O2 — CID 121410178
5-[4-(4-fluoropiperidin-1-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 121410178) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 5-[4-(4-fluoropiperidin-1-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[4-(4-fluoropiperidin-1-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410178 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 5-[4-(4-fluoropiperidin-1-yl)anilino]-3-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Nc3ccc(N4CCC(F)CC4)cc3)c2C(N)=O)cc(C)c1O |
| InChI | InChI=1S/C24H29FN6O2/c1-14-11-16(12-15(2)21(14)32)13-27-23-20(22(26)33)24(30-29-23)28-18-3-5-19(6-4-18)31-9-7-17(25)8-10-31/h3-6,11-12,17,32H,7-10,13H2,1-2H3,(H2,26,33)(H3,27,28,29,30) |
| InChIKey | SWCMLHYHJTVFJQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|