C26H27F7N4 — CID 121410516
N-[3,5-difluoro-4-[(1S,3S)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 121410516) has the molecular formula C26H27F7N4 and a molecular weight of 528.52 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[(1S,3S)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[3,5-difluoro-4-[(1S,3S)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 121410516 |
| Molecular Formula | C26H27F7N4 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[3,5-difluoro-4-[(1S,3S)-8-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@H]1Cc2c([nH]c3c(F)cccc23)[C@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H27F7N4/c1-14-8-18-17-4-2-5-19(28)23(17)35-24(18)25(37(14)13-26(31,32)33)22-20(29)9-15(10-21(22)30)34-16-11-36(12-16)7-3-6-27/h2,4-5,9-10,14,16,25,34-35H,3,6-8,11-13H2,1H3/t14-,25-/m0/s1 |
| InChIKey | YKIQKXYDDXCUPR-SXBQZSJRSA-N |
| XLogP | 5.94 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|