C26H29F5N4 — CID 121410535
N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 121410535) has the molecular formula C26H29F5N4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 121410535 |
| Molecular Formula | C26H29F5N4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)F |
| InChI | InChI=1S/C26H29F5N4/c1-15-9-19-18-5-2-3-6-22(18)33-25(19)26(35(15)14-23(30)31)24-20(28)10-16(11-21(24)29)32-17-12-34(13-17)8-4-7-27/h2-3,5-6,10-11,15,17,23,26,32-33H,4,7-9,12-14H2,1H3/t15-,26-/m1/s1 |
| InChIKey | DVZRNWXCWBKUMR-PVPMGCCUSA-N |
| XLogP | 5.50 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|