C30H27F6N3O2 — CID 121410560
3-[(1S,3S)-1-[2,6-difluoro-4-[1-(3-fluorophenyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 121410560) has the molecular formula C30H27F6N3O2 and a molecular weight of 575.55 g/mol. Its IUPAC name is 3-[(1S,3S)-1-[2,6-difluoro-4-[1-(3-fluorophenyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1S,3S)-1-[2,6-difluoro-4-[1-(3-fluorophenyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 121410560 |
| Molecular Formula | C30H27F6N3O2 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 3-[(1S,3S)-1-[2,6-difluoro-4-[1-(3-fluorophenyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | C[C@H]1Cc2c([nH]c3ccc(F)cc23)[C@H](c2c(F)cc(OC3CN(c4cccc(F)c4)C3)cc2F)N1CC(F)(F)CO |
| InChI | InChI=1S/C30H27F6N3O2/c1-16-7-23-22-9-18(32)5-6-26(22)37-28(23)29(39(16)14-30(35,36)15-40)27-24(33)10-20(11-25(27)34)41-21-12-38(13-21)19-4-2-3-17(31)8-19/h2-6,8-11,16,21,29,37,40H,7,12-15H2,1H3/t16-,29-/m0/s1 |
| InChIKey | FHXHZNKLVLOYSA-OFJJUDJNSA-N |
| XLogP | 5.96 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|