C27H31F5N4 — CID 121410581
N-[4-[(1R)-2-(2,2-difluoroethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 121410581) has the molecular formula C27H31F5N4 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-[4-[(1R)-2-(2,2-difluoroethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(1R)-2-(2,2-difluoroethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 121410581 |
| Molecular Formula | C27H31F5N4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[4-[(1R)-2-(2,2-difluoroethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | CC1(C)Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)F |
| InChI | InChI=1S/C27H31F5N4/c1-27(2)12-19-18-6-3-4-7-22(18)34-25(19)26(36(27)15-23(31)32)24-20(29)10-16(11-21(24)30)33-17-13-35(14-17)9-5-8-28/h3-4,6-7,10-11,17,23,26,33-34H,5,8-9,12-15H2,1-2H3/t26-/m1/s1 |
| InChIKey | IGKRPAKADHIFRZ-AREMUKBSSA-N |
| XLogP | 5.89 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|