C29H34F3N3O3 — CID 121410598
3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 121410598) has the molecular formula C29H34F3N3O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 121410598 |
| Molecular Formula | C29H34F3N3O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)N1CC(C)(C)C(=O)O |
| InChI | InChI=1S/C29H34F3N3O3/c1-17-10-21-20-6-4-5-7-24(20)33-26(21)27(35(17)16-29(2,3)28(36)37)25-22(31)11-19(12-23(25)32)38-9-8-34-14-18(13-30)15-34/h4-7,11-12,17-18,27,33H,8-10,13-16H2,1-3H3,(H,36,37)/t17-,27-/m1/s1 |
| InChIKey | GNXUMNYCHHMEEG-XGCWNURASA-N |
| XLogP | 5.17 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|