C28H35F2N3O2 — CID 121410599
(2S)-2-fluoro-3-[(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol (PubChem CID 121410599) has the molecular formula C28H35F2N3O2 and a molecular weight of 483.60 g/mol. Its IUPAC name is (2S)-2-fluoro-3-[(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol.
| Compound Name | (2S)-2-fluoro-3-[(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 121410599 |
| Molecular Formula | C28H35F2N3O2 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (2S)-2-fluoro-3-[(1R,3R)-1-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)N1C[C@](C)(F)CO |
| InChI | InChI=1S/C28H35F2N3O2/c1-19-13-24-23-5-3-4-6-25(23)31-26(24)27(33(19)17-28(2,30)18-34)21-7-9-22(10-8-21)35-12-11-32-15-20(14-29)16-32/h3-10,19-20,27,31,34H,11-18H2,1-2H3/t19-,27-,28+/m1/s1 |
| InChIKey | JEBMKKMBJUSTBH-LHXLBICKSA-N |
| XLogP | 4.50 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|