C26H28F6N4 — CID 121410619
3,5-difluoro-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]aniline (PubChem CID 121410619) has the molecular formula C26H28F6N4 and a molecular weight of 510.53 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]aniline.
| Compound Name | 3,5-difluoro-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]aniline |
|---|---|
| PubChem CID | 121410619 |
| Molecular Formula | C26H28F6N4 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 3,5-difluoro-N-[2-[3-(fluoromethyl)azetidin-1-yl]ethyl]-4-[(1R,3R)-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]aniline |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NCCN3CC(CF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H28F6N4/c1-15-8-19-18-4-2-3-5-22(18)34-24(19)25(36(15)14-26(30,31)32)23-20(28)9-17(10-21(23)29)33-6-7-35-12-16(11-27)13-35/h2-5,9-10,15-16,25,33-34H,6-8,11-14H2,1H3/t15-,25-/m1/s1 |
| InChIKey | ZNDGFSKAUXDEGE-SGANQWHYSA-N |
| XLogP | 5.66 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|