C27H30F6N4O — CID 121410663
3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 121410663) has the molecular formula C27H30F6N4O and a molecular weight of 540.55 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 121410663 |
| Molecular Formula | C27H30F6N4O |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3cc(F)ccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H30F6N4O/c1-15-7-20-19-4-3-16(29)8-23(19)35-25(20)26(37(15)13-27(32,33)14-38)24-21(30)9-17(10-22(24)31)34-18-11-36(12-18)6-2-5-28/h3-4,8-10,15,18,26,34-35,38H,2,5-7,11-14H2,1H3/t15-,26-/m1/s1 |
| InChIKey | NESQDZKUKHWOLS-PVPMGCCUSA-N |
| XLogP | 5.00 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|