C29H27Cl2FN2O5S — CID 121410759
2-[(1R,4S)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-1-hydroxy-2,2-dimethylcyclohexyl]-4-fluoro-1,3-benzothiazole-6-carboxylic acid (PubChem CID 121410759) has the molecular formula C29H27Cl2FN2O5S and a molecular weight of 605.52 g/mol. Its IUPAC name is 2-[(1R,4S)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-1-hydroxy-2,2-dimethylcyclohexyl]-4-fluoro-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(1R,4S)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-1-hydroxy-2,2-dimethylcyclohexyl]-4-fluoro-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 121410759 |
| Molecular Formula | C29H27Cl2FN2O5S |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 2-[(1R,4S)-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-1-hydroxy-2,2-dimethylcyclohexyl]-4-fluoro-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CC1(C)C[C@@H](OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)CC[C@]1(O)c1nc2c(F)cc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C29H27Cl2FN2O5S/c1-28(2)12-16(8-9-29(28,37)27-33-24-20(32)10-15(26(35)36)11-21(24)40-27)38-13-17-23(34-39-25(17)14-6-7-14)22-18(30)4-3-5-19(22)31/h3-5,10-11,14,16,37H,6-9,12-13H2,1-2H3,(H,35,36)/t16-,29-/m0/s1 |
| InChIKey | BBLKGNLHTAFNHK-OFJJUDJNSA-N |
| XLogP | 7.96 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |