C27H28F5N3O2 — CID 121410763
1-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-one (PubChem CID 121410763) has the molecular formula C27H28F5N3O2 and a molecular weight of 521.53 g/mol. Its IUPAC name is 1-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-one.
| Compound Name | 1-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-one |
|---|---|
| PubChem CID | 121410763 |
| Molecular Formula | C27H28F5N3O2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 1-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-one |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)N1C(=O)C(C)(F)F |
| InChI | InChI=1S/C27H28F5N3O2/c1-15-9-19-18-5-3-4-6-22(18)33-24(19)25(35(15)26(36)27(2,31)32)23-20(29)10-17(11-21(23)30)37-8-7-34-13-16(12-28)14-34/h3-6,10-11,15-16,25,33H,7-9,12-14H2,1-2H3/t15-,25-/m1/s1 |
| InChIKey | MTWKAJZFKRYWKL-SGANQWHYSA-N |
| XLogP | 5.24 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|