C22H22BrF3N2 — CID 121410778
(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 121410778) has the molecular formula C22H22BrF3N2 and a molecular weight of 451.33 g/mol. Its IUPAC name is (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 121410778 |
| Molecular Formula | C22H22BrF3N2 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(Br)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C22H22BrF3N2/c1-12-8-15-14-6-4-5-7-18(14)27-20(15)21(28(12)11-22(2,3)26)19-16(24)9-13(23)10-17(19)25/h4-7,9-10,12,21,27H,8,11H2,1-3H3/t12-,21-/m1/s1 |
| InChIKey | GNNLAHQBVALMPT-XUSGNXJCSA-N |
| XLogP | 6.29 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|