C28H32F3N3O3 — CID 121410863
(2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid (PubChem CID 121410863) has the molecular formula C28H32F3N3O3 and a molecular weight of 515.58 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121410863 |
| Molecular Formula | C28H32F3N3O3 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-methylpropanoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)N1C[C@H](C)C(=O)O |
| InChI | InChI=1S/C28H32F3N3O3/c1-16(28(35)36)13-34-17(2)9-21-20-5-3-4-6-24(20)32-26(21)27(34)25-22(30)10-19(11-23(25)31)37-8-7-33-14-18(12-29)15-33/h3-6,10-11,16-18,27,32H,7-9,12-15H2,1-2H3,(H,35,36)/t16-,17+,27+/m0/s1 |
| InChIKey | ZGEXPPPWQILEIO-ANAQZDLVSA-N |
| XLogP | 4.78 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|