C29H37F2N3O — CID 121410880
(R)-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-[1-(3-fluoropropyl)azetidin-3-yl]methanol (PubChem CID 121410880) has the molecular formula C29H37F2N3O and a molecular weight of 481.63 g/mol. Its IUPAC name is (R)-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-[1-(3-fluoropropyl)azetidin-3-yl]methanol.
| Compound Name | (R)-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-[1-(3-fluoropropyl)azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 121410880 |
| Molecular Formula | C29H37F2N3O |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | (R)-[4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-[1-(3-fluoropropyl)azetidin-3-yl]methanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc([C@H](O)C3CN(CCCF)C3)cc2)N1CC(C)(C)F |
| InChI | InChI=1S/C29H37F2N3O/c1-19-15-24-23-7-4-5-8-25(23)32-26(24)27(34(19)18-29(2,3)31)20-9-11-21(12-10-20)28(35)22-16-33(17-22)14-6-13-30/h4-5,7-12,19,22,27-28,32,35H,6,13-18H2,1-3H3/t19-,27-,28+/m1/s1 |
| InChIKey | SVDAMJOWIOJLPJ-LHXLBICKSA-N |
| XLogP | 5.58 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|