About 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole
7-(1,3-dioxolan-2-yl)-1,3-benzothiazole (PubChem CID 121411091) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole |
| PubChem CID | 121411091 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole |
| SMILES | c1cc(C2OCCO2)c2scnc2c1 |
| InChI | InChI=1S/C10H9NO2S/c1-2-7(10-12-4-5-13-10)9-8(3-1)11-6-14-9/h1-3,6,10H,4-5H2 |
| InChIKey | VYTBCRQXFVCNJZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole?
The IUPAC name of 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole (CID 121411091) is 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole.
What is the SMILES notation for 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole?
The canonical SMILES for 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole is c1cc(C2OCCO2)c2scnc2c1.
What is the InChIKey of 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole?
The InChIKey is VYTBCRQXFVCNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-2-7(10-12-4-5-13-10)9-8(3-1)11-6-14-9/h1-3,6,10H,4-5H2.
What are the key properties of 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole?
7-(1,3-dioxolan-2-yl)-1,3-benzothiazole has a molecular weight of 207.25 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dioxolan-2-yl)-1,3-benzothiazole is sourced from PubChem (CID 121411091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).