C27H34F2N4O — CID 121411115
(1R,3R)-1-[6-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-3-pyridinyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 121411115) has the molecular formula C27H34F2N4O and a molecular weight of 468.59 g/mol. Its IUPAC name is (1R,3R)-1-[6-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-3-pyridinyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[6-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-3-pyridinyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 121411115 |
| Molecular Formula | C27H34F2N4O |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1R,3R)-1-[6-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]-3-pyridinyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCN3CC(CF)C3)nc2)N1CC(C)(C)F |
| InChI | InChI=1S/C27H34F2N4O/c1-18-12-22-21-6-4-5-7-23(21)31-25(22)26(33(18)17-27(2,3)29)20-8-9-24(30-14-20)34-11-10-32-15-19(13-28)16-32/h4-9,14,18-19,26,31H,10-13,15-17H2,1-3H3/t18-,26-/m1/s1 |
| InChIKey | HMBHYZQMMZFMAK-WXTAPIANSA-N |
| XLogP | 4.93 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|