C9H8BrFO2 — CID 121412474
4-bromo-5-fluoro-2-methoxy-2,3-dihydro-1-benzofuran (PubChem CID 121412474) has the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-methoxy-2,3-dihydro-1-benzofuran.
| Compound Name | 4-bromo-5-fluoro-2-methoxy-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 121412474 |
| Molecular Formula | C9H8BrFO2 |
| Molecular Weight | 247.06 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 4-bromo-5-fluoro-2-methoxy-2,3-dihydro-1-benzofuran |
| SMILES | COC1Cc2c(ccc(F)c2Br)O1 |
| InChI | InChI=1S/C9H8BrFO2/c1-12-8-4-5-7(13-8)3-2-6(11)9(5)10/h2-3,8H,4H2,1H3 |
| InChIKey | YNVAGVFNKOCLMH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |