About 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile
5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile (PubChem CID 121412588) has the molecular formula C9H6FNO2
and a molecular weight of 179.15 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile |
| PubChem CID | 121412588 |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile |
| SMILES | N#Cc1c(F)ccc2c1C(O)CO2 |
| InChI | InChI=1S/C9H6FNO2/c10-6-1-2-8-9(5(6)3-11)7(12)4-13-8/h1-2,7,12H,4H2 |
| InChIKey | CXBHZHNIOJOJBG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile?
The IUPAC name of 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile (CID 121412588) is 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile.
What is the SMILES notation for 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile?
The canonical SMILES for 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile is N#Cc1c(F)ccc2c1C(O)CO2.
What is the InChIKey of 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile?
The InChIKey is CXBHZHNIOJOJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO2/c10-6-1-2-8-9(5(6)3-11)7(12)4-13-8/h1-2,7,12H,4H2.
What are the key properties of 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile?
5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile has a molecular weight of 179.15 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-hydroxy-2,3-dihydro-1-benzofuran-4-carbonitrile is sourced from PubChem (CID 121412588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).