About (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid
(2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 121412808) has the molecular formula C9H10N2O6
and a molecular weight of 242.19 g/mol. Its IUPAC name is (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
| PubChem CID | 121412808 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CN1C(=O)C=CC1=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H10N2O6/c12-4-5(9(16)17)10-6(13)3-11-7(14)1-2-8(11)15/h1-2,5,12H,3-4H2,(H,10,13)(H,16,17)/t5-/m0/s1 |
| InChIKey | SQMUYTKNDSMTOA-YFKPBYRVSA-N |
| XLogP | -2.53 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid?
The IUPAC name of (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid (CID 121412808) is (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid.
What is the SMILES notation for (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid?
The canonical SMILES for (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid is O=C(CN1C(=O)C=CC1=O)N[C@@H](CO)C(=O)O.
What is the InChIKey of (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid?
The InChIKey is SQMUYTKNDSMTOA-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H10N2O6/c12-4-5(9(16)17)10-6(13)3-11-7(14)1-2-8(11)15/h1-2,5,12H,3-4H2,(H,10,13)(H,16,17)/t5-/m0/s1.
What are the key properties of (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid?
(2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid has a molecular weight of 242.19 g/mol, XLogP of -2.53, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxypropanoic acid is sourced from PubChem (CID 121412808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).