C19H24FN3 — CID 121413050
1-(4-fluorophenyl)-N-[(4-methylpiperidin-4-yl)methyl]-1-pyridin-2-ylmethanamine (PubChem CID 121413050) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(4-methylpiperidin-4-yl)methyl]-1-pyridin-2-ylmethanamine.
| Compound Name | 1-(4-fluorophenyl)-N-[(4-methylpiperidin-4-yl)methyl]-1-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 121413050 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(4-methylpiperidin-4-yl)methyl]-1-pyridin-2-ylmethanamine |
| SMILES | CC1(CNC(c2ccc(F)cc2)c2ccccn2)CCNCC1 |
| InChI | InChI=1S/C19H24FN3/c1-19(9-12-21-13-10-19)14-23-18(17-4-2-3-11-22-17)15-5-7-16(20)8-6-15/h2-8,11,18,21,23H,9-10,12-14H2,1H3 |
| InChIKey | SYLSWCGHDXGVIF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |