C26H28FN3O2 — CID 121413387
N-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-N-(2-phenoxyethyl)piperidine-4-carboxamide (PubChem CID 121413387) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-N-(2-phenoxyethyl)piperidine-4-carboxamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-N-(2-phenoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121413387 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-pyridin-2-ylmethyl]-N-(2-phenoxyethyl)piperidine-4-carboxamide |
| SMILES | O=C(C1CCNCC1)N(CCOc1ccccc1)[C@@H](c1ccc(F)cc1)c1ccccn1 |
| InChI | InChI=1S/C26H28FN3O2/c27-22-11-9-20(10-12-22)25(24-8-4-5-15-29-24)30(26(31)21-13-16-28-17-14-21)18-19-32-23-6-2-1-3-7-23/h1-12,15,21,25,28H,13-14,16-19H2/t25-/m0/s1 |
| InChIKey | KHRKCFZQPZFISE-VWLOTQADSA-N |
| XLogP | 4.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |